About 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane
1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane (PubChem CID 143769342) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane.
Molecular Properties
| Compound Name | 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane |
| PubChem CID | 143769342 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane |
| SMILES | C.CC.CC(=O)N1c2ccc(N)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C14H18N2O.C2H6.CH4/c1-9-8-14(3,4)16(10(2)17)13-6-5-11(15)7-12(9)13;1-2;/h5-8H,15H2,1-4H3;1-2H3;1H4 |
| InChIKey | FLYCWRQMBATROF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane?
The IUPAC name of 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane (CID 143769342) is 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane.
What is the SMILES notation for 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane?
The canonical SMILES for 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane is C.CC.CC(=O)N1c2ccc(N)cc2C(C)=CC1(C)C.
What is the InChIKey of 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane?
The InChIKey is FLYCWRQMBATROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O.C2H6.CH4/c1-9-8-14(3,4)16(10(2)17)13-6-5-11(15)7-12(9)13;1-2;/h5-8H,15H2,1-4H3;1-2H3;1H4.
What are the key properties of 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane?
1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane has a molecular weight of 276.42 g/mol, XLogP of 4.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-2,2,4-trimethylquinolin-1-yl)ethanone;ethane;methane is sourced from PubChem (CID 143769342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).