About 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide
2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide (PubChem CID 143770601) has the molecular formula C10H17NO2S3
and a molecular weight of 279.45 g/mol. Its IUPAC name is 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide.
Molecular Properties
| Compound Name | 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide |
| PubChem CID | 143770601 |
| Molecular Formula | C10H17NO2S3 |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide |
| SMILES | CCN(CC)C(=S)CS(O)(O)c1cccs1 |
| InChI | InChI=1S/C10H17NO2S3/c1-3-11(4-2)9(14)8-16(12,13)10-6-5-7-15-10/h5-7,12-13H,3-4,8H2,1-2H3 |
| InChIKey | NKRNPUHLNJVOBJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide?
The IUPAC name of 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide (CID 143770601) is 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide.
What is the SMILES notation for 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide?
The canonical SMILES for 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide is CCN(CC)C(=S)CS(O)(O)c1cccs1.
What is the InChIKey of 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide?
The InChIKey is NKRNPUHLNJVOBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2S3/c1-3-11(4-2)9(14)8-16(12,13)10-6-5-7-15-10/h5-7,12-13H,3-4,8H2,1-2H3.
What are the key properties of 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide?
2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide has a molecular weight of 279.45 g/mol, XLogP of 3.53, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[dihydroxy(thiophen-2-yl)-λ4-sulfanyl]-N,N-diethylethanethioamide is sourced from PubChem (CID 143770601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).