C17H19F3N2O2 — CID 143770990
piperidin-1-yl-[4-[(Z)-4,4,4-trifluoro-3-methoxybut-2-enimidoyl]phenyl]methanone (PubChem CID 143770990) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.35 g/mol. Its IUPAC name is piperidin-1-yl-[4-[(Z)-4,4,4-trifluoro-3-methoxybut-2-enimidoyl]phenyl]methanone.
| Compound Name | piperidin-1-yl-[4-[(Z)-4,4,4-trifluoro-3-methoxybut-2-enimidoyl]phenyl]methanone |
|---|---|
| PubChem CID | 143770990 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | piperidin-1-yl-[4-[(Z)-4,4,4-trifluoro-3-methoxybut-2-enimidoyl]phenyl]methanone |
| SMILES | [H]/N=C(/C=C(\OC)C(F)(F)F)c1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H19F3N2O2/c1-24-15(17(18,19)20)11-14(21)12-5-7-13(8-6-12)16(23)22-9-3-2-4-10-22/h5-8,11,21H,2-4,9-10H2,1H3/b15-11-,21-14- |
| InChIKey | AYSDKZCOEVDPNK-WDZPDTQSSA-N |
| XLogP | 3.77 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|