C18H21N5O7 — CID 143771058
[5-(12-amino-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-4-methyloxolan-2-yl]methyl acetate;carbonic acid (PubChem CID 143771058) has the molecular formula C18H21N5O7 and a molecular weight of 419.39 g/mol. Its IUPAC name is [5-(12-amino-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-4-methyloxolan-2-yl]methyl acetate;carbonic acid.
| Compound Name | [5-(12-amino-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-4-methyloxolan-2-yl]methyl acetate;carbonic acid |
|---|---|
| PubChem CID | 143771058 |
| Molecular Formula | C18H21N5O7 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [5-(12-amino-10-oxo-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-3-yl)-4-methyloxolan-2-yl]methyl acetate;carbonic acid |
| SMILES | CC(=O)OCC1CC(C)C(n2cc3c(N)cc(=O)nc4c3c2N=CN4)O1.O=C(O)O |
| InChI | InChI=1S/C17H19N5O4.CH2O3/c1-8-3-10(6-25-9(2)23)26-17(8)22-5-11-12(18)4-13(24)21-15-14(11)16(22)20-7-19-15;2-1(3)4/h4-5,7-8,10,17H,3,6,18H2,1-2H3,(H,19,20,21,24);(H2,2,3,4) |
| InChIKey | DUTAIGYDZFJCGB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 178.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |