C20H17ClO3S — CID 143771550
(2S,6R)-4-[5-(4-chlorophenyl)-2-methylthiophen-3-yl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 143771550) has the molecular formula C20H17ClO3S and a molecular weight of 372.87 g/mol. Its IUPAC name is (2S,6R)-4-[5-(4-chlorophenyl)-2-methylthiophen-3-yl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (2S,6R)-4-[5-(4-chlorophenyl)-2-methylthiophen-3-yl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 143771550 |
| Molecular Formula | C20H17ClO3S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (2S,6R)-4-[5-(4-chlorophenyl)-2-methylthiophen-3-yl]-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1sc(-c2ccc(Cl)cc2)cc1C1C(=O)[C@@H]2C3CCC(O3)[C@@H]2C1=O |
| InChI | InChI=1S/C20H17ClO3S/c1-9-12(8-15(25-9)10-2-4-11(21)5-3-10)16-19(22)17-13-6-7-14(24-13)18(17)20(16)23/h2-5,8,13-14,16-18H,6-7H2,1H3/t13?,14?,16?,17-,18+ |
| InChIKey | PXTXVVYODJYZQM-DITMGKQQSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|