C23H34N2O — CID 143772057
2,2-dimethylpropane;3-(5-ethyl-2-pyridinyl)-N-methylbenzamide;prop-1-ene (PubChem CID 143772057) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 2,2-dimethylpropane;3-(5-ethyl-2-pyridinyl)-N-methylbenzamide;prop-1-ene.
| Compound Name | 2,2-dimethylpropane;3-(5-ethyl-2-pyridinyl)-N-methylbenzamide;prop-1-ene |
|---|---|
| PubChem CID | 143772057 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 2,2-dimethylpropane;3-(5-ethyl-2-pyridinyl)-N-methylbenzamide;prop-1-ene |
| SMILES | C=CC.CC(C)(C)C.CCc1ccc(-c2cccc(C(=O)NC)c2)nc1 |
| InChI | InChI=1S/C15H16N2O.C5H12.C3H6/c1-3-11-7-8-14(17-10-11)12-5-4-6-13(9-12)15(18)16-2;1-5(2,3)4;1-3-2/h4-10H,3H2,1-2H3,(H,16,18);1-4H3;3H,1H2,2H3 |
| InChIKey | PWROKGHZQRFJKQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|