C29H32BrN5O4 — CID 143772229
1-[[7-bromo-4-[(4-methylpiperazin-1-yl)methyl]quinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione;3-methoxybenzaldehyde (PubChem CID 143772229) has the molecular formula C29H32BrN5O4 and a molecular weight of 594.51 g/mol. Its IUPAC name is 1-[[7-bromo-4-[(4-methylpiperazin-1-yl)methyl]quinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione;3-methoxybenzaldehyde.
| Compound Name | 1-[[7-bromo-4-[(4-methylpiperazin-1-yl)methyl]quinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione;3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 143772229 |
| Molecular Formula | C29H32BrN5O4 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | 1-[[7-bromo-4-[(4-methylpiperazin-1-yl)methyl]quinolin-2-yl]amino]-3,4-dimethylpyrrole-2,5-dione;3-methoxybenzaldehyde |
| SMILES | CC1=C(C)C(=O)N(Nc2cc(CN3CCN(C)CC3)c3ccc(Br)cc3n2)C1=O.COc1cccc(C=O)c1 |
| InChI | InChI=1S/C21H24BrN5O2.C8H8O2/c1-13-14(2)21(29)27(20(13)28)24-19-10-15(12-26-8-6-25(3)7-9-26)17-5-4-16(22)11-18(17)23-19;1-10-8-4-2-3-7(5-8)6-9/h4-5,10-11H,6-9,12H2,1-3H3,(H,23,24);2-6H,1H3 |
| InChIKey | BCPHTIVHEJWQHX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|