About 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane
5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane (PubChem CID 143772320) has the molecular formula C18H24F2N2
and a molecular weight of 306.40 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane.
Molecular Properties
| Compound Name | 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane |
| PubChem CID | 143772320 |
| Molecular Formula | C18H24F2N2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane |
| SMILES | CC(C)C.CNc1ccc(C(C)(F)F)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H14F2N2.C4H10/c1-14(15,16)11-8-9-12(17-2)18-13(11)10-6-4-3-5-7-10;1-4(2)3/h3-9H,1-2H3,(H,17,18);4H,1-3H3 |
| InChIKey | DKZRZOAVDMFHLT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane?
The IUPAC name of 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane (CID 143772320) is 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane.
What is the SMILES notation for 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane?
The canonical SMILES for 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane is CC(C)C.CNc1ccc(C(C)(F)F)c(-c2ccccc2)n1.
What is the InChIKey of 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane?
The InChIKey is DKZRZOAVDMFHLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2.C4H10/c1-14(15,16)11-8-9-12(17-2)18-13(11)10-6-4-3-5-7-10;1-4(2)3/h3-9H,1-2H3,(H,17,18);4H,1-3H3.
What are the key properties of 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane?
5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane has a molecular weight of 306.40 g/mol, XLogP of 5.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoroethyl)-N-methyl-6-phenylpyridin-2-amine;2-methylpropane is sourced from PubChem (CID 143772320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).