C32H34F4O — CID 143772372
(1Z)-4-methyl-2-methylidene-1-[(4Z,8Z,12Z)-4,5,12,13-tetrafluoro-2,3,6,7,10,11-hexamethylidene-14-prop-2-enoxypentadeca-4,8,12,14-tetraenylidene]cyclohexane (PubChem CID 143772372) has the molecular formula C32H34F4O and a molecular weight of 510.62 g/mol. Its IUPAC name is (1Z)-4-methyl-2-methylidene-1-[(4Z,8Z,12Z)-4,5,12,13-tetrafluoro-2,3,6,7,10,11-hexamethylidene-14-prop-2-enoxypentadeca-4,8,12,14-tetraenylidene]cyclohexane.
| Compound Name | (1Z)-4-methyl-2-methylidene-1-[(4Z,8Z,12Z)-4,5,12,13-tetrafluoro-2,3,6,7,10,11-hexamethylidene-14-prop-2-enoxypentadeca-4,8,12,14-tetraenylidene]cyclohexane |
|---|---|
| PubChem CID | 143772372 |
| Molecular Formula | C32H34F4O |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (1Z)-4-methyl-2-methylidene-1-[(4Z,8Z,12Z)-4,5,12,13-tetrafluoro-2,3,6,7,10,11-hexamethylidene-14-prop-2-enoxypentadeca-4,8,12,14-tetraenylidene]cyclohexane |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(=C)/C=C1/CCC(C)CC1=C |
| InChI | InChI=1S/C32H34F4O/c1-11-16-37-27(10)32(36)31(35)25(8)21(4)14-13-20(3)24(7)29(33)30(34)26(9)22(5)18-28-15-12-19(2)17-23(28)6/h11,13-14,18-19H,1,3-10,12,15-17H2,2H3/b14-13-,28-18-,30-29-,32-31- |
| InChIKey | YRNKENLEQGVFGK-GJENQGBQSA-N |
| XLogP | 10.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|