C28H37F3O2 — CID 143772402
(3Z,7Z,11E)-3,4,12-trifluoro-14-(2-methylbutoxy)-5,6,9,10,13-pentamethylidene-2-propoxypentadeca-1,3,7,11-tetraene (PubChem CID 143772402) has the molecular formula C28H37F3O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is (3Z,7Z,11E)-3,4,12-trifluoro-14-(2-methylbutoxy)-5,6,9,10,13-pentamethylidene-2-propoxypentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-3,4,12-trifluoro-14-(2-methylbutoxy)-5,6,9,10,13-pentamethylidene-2-propoxypentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772402 |
| Molecular Formula | C28H37F3O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | (3Z,7Z,11E)-3,4,12-trifluoro-14-(2-methylbutoxy)-5,6,9,10,13-pentamethylidene-2-propoxypentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)OCCC)C(=C)/C=C(\F)C(=C)C(C)OCC(C)CC |
| InChI | InChI=1S/C28H37F3O2/c1-11-15-32-25(10)28(31)27(30)22(7)20(5)14-13-19(4)21(6)16-26(29)23(8)24(9)33-17-18(3)12-2/h13-14,16,18,24H,4-8,10-12,15,17H2,1-3,9H3/b14-13-,26-16+,28-27- |
| InChIKey | PKTXRPQCPKPFFU-LOPIBGSJSA-N |
| XLogP | 8.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|