C34H45F3O — CID 143772470
(3Z,7Z,11E,14E)-3,4,12-trifluoro-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxydocosa-1,3,7,11,14-pentaene (PubChem CID 143772470) has the molecular formula C34H45F3O and a molecular weight of 526.73 g/mol. Its IUPAC name is (3Z,7Z,11E,14E)-3,4,12-trifluoro-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxydocosa-1,3,7,11,14-pentaene.
| Compound Name | (3Z,7Z,11E,14E)-3,4,12-trifluoro-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxydocosa-1,3,7,11,14-pentaene |
|---|---|
| PubChem CID | 143772470 |
| Molecular Formula | C34H45F3O |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | (3Z,7Z,11E,14E)-3,4,12-trifluoro-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxydocosa-1,3,7,11,14-pentaene |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C=C(/F)C(=C)/C(C)=C/CC(C)C(C)CCC(C)C |
| InChI | InChI=1S/C34H45F3O/c1-13-20-38-31(12)34(37)33(36)30(11)27(8)19-17-25(6)28(9)21-32(35)29(10)26(7)18-16-24(5)23(4)15-14-22(2)3/h13,17-19,21-24H,1,6,8-12,14-16,20H2,2-5,7H3/b19-17-,26-18+,32-21+,34-33- |
| InChIKey | XEBGPYMNTBATHG-JDNHWVIRSA-N |
| XLogP | 11.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|