C30H39F3O — CID 143772490
(8Z,12Z,16E)-8,9,16-trifluoro-19-methyl-7,10,11,14,15,18-hexamethylidene-20-propan-2-yloxyicosa-1,8,12,16-tetraene (PubChem CID 143772490) has the molecular formula C30H39F3O and a molecular weight of 472.64 g/mol. Its IUPAC name is (8Z,12Z,16E)-8,9,16-trifluoro-19-methyl-7,10,11,14,15,18-hexamethylidene-20-propan-2-yloxyicosa-1,8,12,16-tetraene.
| Compound Name | (8Z,12Z,16E)-8,9,16-trifluoro-19-methyl-7,10,11,14,15,18-hexamethylidene-20-propan-2-yloxyicosa-1,8,12,16-tetraene |
|---|---|
| PubChem CID | 143772490 |
| Molecular Formula | C30H39F3O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | (8Z,12Z,16E)-8,9,16-trifluoro-19-methyl-7,10,11,14,15,18-hexamethylidene-20-propan-2-yloxyicosa-1,8,12,16-tetraene |
| SMILES | C=CCCCCC(=C)/C(F)=C(/F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C\C(=C)C(C)COC(C)C |
| InChI | InChI=1S/C30H39F3O/c1-11-12-13-14-15-23(6)29(32)30(33)27(10)22(5)17-16-21(4)26(9)28(31)18-24(7)25(8)19-34-20(2)3/h11,16-18,20,25H,1,4-7,9-10,12-15,19H2,2-3,8H3/b17-16-,28-18+,30-29- |
| InChIKey | UVNPHMFJSXIFGF-GEBQZEQVSA-N |
| XLogP | 9.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|