C26H31F3O — CID 143772508
(5Z,9Z,13E)-17-ethoxy-5,6,13-trifluoro-16-methyl-4,7,8,11,12,15-hexamethylideneheptadeca-1,5,9,13-tetraene (PubChem CID 143772508) has the molecular formula C26H31F3O and a molecular weight of 416.53 g/mol. Its IUPAC name is (5Z,9Z,13E)-17-ethoxy-5,6,13-trifluoro-16-methyl-4,7,8,11,12,15-hexamethylideneheptadeca-1,5,9,13-tetraene.
| Compound Name | (5Z,9Z,13E)-17-ethoxy-5,6,13-trifluoro-16-methyl-4,7,8,11,12,15-hexamethylideneheptadeca-1,5,9,13-tetraene |
|---|---|
| PubChem CID | 143772508 |
| Molecular Formula | C26H31F3O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (5Z,9Z,13E)-17-ethoxy-5,6,13-trifluoro-16-methyl-4,7,8,11,12,15-hexamethylideneheptadeca-1,5,9,13-tetraene |
| SMILES | C=CCC(=C)/C(F)=C(/F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C\C(=C)C(C)COCC |
| InChI | InChI=1S/C26H31F3O/c1-10-12-19(5)25(28)26(29)23(9)18(4)14-13-17(3)22(8)24(27)15-20(6)21(7)16-30-11-2/h10,13-15,21H,1,3-6,8-9,11-12,16H2,2,7H3/b14-13-,24-15+,26-25- |
| InChIKey | FKGCZYZOWMEOQJ-KQDHSHKUSA-N |
| XLogP | 8.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|