C30H38F4O — CID 143772509
(2Z,8Z,12Z,16Z)-8,9,16,17-tetrafluoro-19-methyl-7,10,11,14,15,18-hexamethylidene-20-propan-2-yloxyicosa-2,8,12,16-tetraene (PubChem CID 143772509) has the molecular formula C30H38F4O and a molecular weight of 490.63 g/mol. Its IUPAC name is (2Z,8Z,12Z,16Z)-8,9,16,17-tetrafluoro-19-methyl-7,10,11,14,15,18-hexamethylidene-20-propan-2-yloxyicosa-2,8,12,16-tetraene.
| Compound Name | (2Z,8Z,12Z,16Z)-8,9,16,17-tetrafluoro-19-methyl-7,10,11,14,15,18-hexamethylidene-20-propan-2-yloxyicosa-2,8,12,16-tetraene |
|---|---|
| PubChem CID | 143772509 |
| Molecular Formula | C30H38F4O |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (2Z,8Z,12Z,16Z)-8,9,16,17-tetrafluoro-19-methyl-7,10,11,14,15,18-hexamethylidene-20-propan-2-yloxyicosa-2,8,12,16-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(C)COC(C)C)C(=C)/C(F)=C(/F)C(=C)CCC/C=C\C |
| InChI | InChI=1S/C30H38F4O/c1-11-12-13-14-15-22(6)27(31)28(32)24(8)20(4)16-17-21(5)25(9)29(33)30(34)26(10)23(7)18-35-19(2)3/h11-12,16-17,19,23H,4-6,8-10,13-15,18H2,1-3,7H3/b12-11-,17-16-,28-27-,30-29- |
| InChIKey | HIGXYHRCYNIFDP-DCUOACDMSA-N |
| XLogP | 9.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|