C32H42F4O — CID 143772574
(3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-2-methoxy-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidenedocosa-1,3,7,11,14-pentaene (PubChem CID 143772574) has the molecular formula C32H42F4O and a molecular weight of 518.68 g/mol. Its IUPAC name is (3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-2-methoxy-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidenedocosa-1,3,7,11,14-pentaene.
| Compound Name | (3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-2-methoxy-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidenedocosa-1,3,7,11,14-pentaene |
|---|---|
| PubChem CID | 143772574 |
| Molecular Formula | C32H42F4O |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | (3Z,7Z,11Z,14E)-3,4,11,12-tetrafluoro-2-methoxy-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidenedocosa-1,3,7,11,14-pentaene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)OC)C(=C)/C(F)=C(/F)C(=C)/C(C)=C/CC(C)C(C)CCC(C)C |
| InChI | InChI=1S/C32H42F4O/c1-19(2)13-14-20(3)21(4)15-16-22(5)25(8)29(33)30(34)26(9)23(6)17-18-24(7)27(10)31(35)32(36)28(11)37-12/h16-21H,6-11,13-15H2,1-5,12H3/b18-17-,22-16+,30-29-,32-31- |
| InChIKey | KGIRXGPTLDJSLZ-RXDRRYSUSA-N |
| XLogP | 10.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|