C27H32F4O2 — CID 143772580
(3Z,7Z,11Z)-3,4,11,12-tetrafluoro-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)-2-[(Z)-prop-1-enoxy]pentadeca-1,3,7,11-tetraene (PubChem CID 143772580) has the molecular formula C27H32F4O2 and a molecular weight of 464.54 g/mol. Its IUPAC name is (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)-2-[(Z)-prop-1-enoxy]pentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)-2-[(Z)-prop-1-enoxy]pentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772580 |
| Molecular Formula | C27H32F4O2 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (3Z,7Z,11Z)-3,4,11,12-tetrafluoro-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)-2-[(Z)-prop-1-enoxy]pentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)C(C)OCC(C)C)C(=C)/C(F)=C(\F)C(=C)O/C=C\C |
| InChI | InChI=1S/C27H32F4O2/c1-11-14-32-23(10)27(31)25(29)20(7)18(5)13-12-17(4)19(6)24(28)26(30)21(8)22(9)33-15-16(2)3/h11-14,16,22H,4-8,10,15H2,1-3,9H3/b13-12-,14-11-,26-24-,27-25- |
| InChIKey | HSSLWTIEUAFTGQ-RINWDLFJSA-N |
| XLogP | 8.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|