C32H45F3O — CID 143772732
(3Z,7Z,11E)-3,4,12-trifluoro-2-methoxy-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidenedocosa-1,3,7,11-tetraene (PubChem CID 143772732) has the molecular formula C32H45F3O and a molecular weight of 502.71 g/mol. Its IUPAC name is (3Z,7Z,11E)-3,4,12-trifluoro-2-methoxy-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidenedocosa-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-3,4,12-trifluoro-2-methoxy-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidenedocosa-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772732 |
| Molecular Formula | C32H45F3O |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | (3Z,7Z,11E)-3,4,12-trifluoro-2-methoxy-14,17,18,21-tetramethyl-5,6,9,10,13-pentamethylidenedocosa-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)OC)C(=C)/C=C(\F)C(=C)C(C)CCC(C)C(C)CCC(C)C |
| InChI | InChI=1S/C32H45F3O/c1-20(2)13-14-21(3)22(4)15-17-24(6)27(9)30(33)19-26(8)23(5)16-18-25(7)28(10)31(34)32(35)29(11)36-12/h16,18-22,24H,5,7-11,13-15,17H2,1-4,6,12H3/b18-16-,30-19+,32-31- |
| InChIKey | UKEIMEJAUWASJB-WIWLZANRSA-N |
| XLogP | 10.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|