C27H33F3O3 — CID 143772798
(3Z,7Z,11E)-3,4,12-trifluoro-14-(2-methoxypropoxy)-5,6,9,10,13-pentamethylidene-2-prop-2-enoxypentadeca-1,3,7,11-tetraene (PubChem CID 143772798) has the molecular formula C27H33F3O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is (3Z,7Z,11E)-3,4,12-trifluoro-14-(2-methoxypropoxy)-5,6,9,10,13-pentamethylidene-2-prop-2-enoxypentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-3,4,12-trifluoro-14-(2-methoxypropoxy)-5,6,9,10,13-pentamethylidene-2-prop-2-enoxypentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143772798 |
| Molecular Formula | C27H33F3O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (3Z,7Z,11E)-3,4,12-trifluoro-14-(2-methoxypropoxy)-5,6,9,10,13-pentamethylidene-2-prop-2-enoxypentadeca-1,3,7,11-tetraene |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C/C(=C)C(=C)/C=C(/F)C(=C)C(C)OCC(C)OC |
| InChI | InChI=1S/C27H33F3O3/c1-11-14-32-24(9)27(30)26(29)21(6)18(3)13-12-17(2)19(4)15-25(28)22(7)23(8)33-16-20(5)31-10/h11-13,15,20,23H,1-4,6-7,9,14,16H2,5,8,10H3/b13-12-,25-15+,27-26- |
| InChIKey | PBCAVJDIQONXNE-HSQZYXTNSA-N |
| XLogP | 7.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|