C20H21F3O — CID 143772899
1-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3-fluorocyclohexa-1,3-diene (PubChem CID 143772899) has the molecular formula C20H21F3O and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3-fluorocyclohexa-1,3-diene.
| Compound Name | 1-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143772899 |
| Molecular Formula | C20H21F3O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3-fluorocyclohexa-1,3-diene |
| SMILES | C=C(/C=C\C(=C)C1=CC(F)=CCC1)C(=C)/C(F)=C(\F)C(=C)OCC |
| InChI | InChI=1S/C20H21F3O/c1-6-24-16(5)20(23)19(22)15(4)13(2)10-11-14(3)17-8-7-9-18(21)12-17/h9-12H,2-8H2,1H3/b11-10-,20-19- |
| InChIKey | XRRUQIODOYQYHQ-WTIALUBOSA-N |
| XLogP | 6.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|