C28H33F3O2 — CID 143772956
(4E,7E,11Z,15Z)-17-but-3-enoxy-7,15,16-trifluoro-5-methyl-6,9,10,13,14-pentamethylideneoctadeca-4,7,11,15,17-pentaen-2-ol (PubChem CID 143772956) has the molecular formula C28H33F3O2 and a molecular weight of 458.56 g/mol. Its IUPAC name is (4E,7E,11Z,15Z)-17-but-3-enoxy-7,15,16-trifluoro-5-methyl-6,9,10,13,14-pentamethylideneoctadeca-4,7,11,15,17-pentaen-2-ol.
| Compound Name | (4E,7E,11Z,15Z)-17-but-3-enoxy-7,15,16-trifluoro-5-methyl-6,9,10,13,14-pentamethylideneoctadeca-4,7,11,15,17-pentaen-2-ol |
|---|---|
| PubChem CID | 143772956 |
| Molecular Formula | C28H33F3O2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (4E,7E,11Z,15Z)-17-but-3-enoxy-7,15,16-trifluoro-5-methyl-6,9,10,13,14-pentamethylideneoctadeca-4,7,11,15,17-pentaen-2-ol |
| SMILES | C=CCCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C/C(=C)C(=C)/C=C(\F)C(=C)/C(C)=C/CC(C)O |
| InChI | InChI=1S/C28H33F3O2/c1-10-11-16-33-25(9)28(31)27(30)24(8)20(4)13-12-18(2)21(5)17-26(29)23(7)19(3)14-15-22(6)32/h10,12-14,17,22,32H,1-2,4-5,7-9,11,15-16H2,3,6H3/b13-12-,19-14+,26-17+,28-27- |
| InChIKey | NDWFOKCRWQSNCR-DAKZYWFYSA-N |
| XLogP | 8.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|