C31H40F4O3 — CID 143773030
(3Z,7Z,11Z)-2-but-3-enoxy-15-(1-butoxyethoxy)-3,4,11,12-tetrafluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene (PubChem CID 143773030) has the molecular formula C31H40F4O3 and a molecular weight of 536.65 g/mol. Its IUPAC name is (3Z,7Z,11Z)-2-but-3-enoxy-15-(1-butoxyethoxy)-3,4,11,12-tetrafluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11Z)-2-but-3-enoxy-15-(1-butoxyethoxy)-3,4,11,12-tetrafluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143773030 |
| Molecular Formula | C31H40F4O3 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (3Z,7Z,11Z)-2-but-3-enoxy-15-(1-butoxyethoxy)-3,4,11,12-tetrafluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
| SMILES | C=CCCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)C(C)COC(C)OCCCC |
| InChI | InChI=1S/C31H40F4O3/c1-11-13-17-36-26(9)31(35)30(34)24(7)21(4)16-15-20(3)23(6)28(32)29(33)25(8)22(5)19-38-27(10)37-18-14-12-2/h11,15-16,22,27H,1,3-4,6-9,12-14,17-19H2,2,5,10H3/b16-15-,29-28-,31-30- |
| InChIKey | MPTZZSVOIPZSLY-NQCXVMOPSA-N |
| XLogP | 9.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|