C29H37F3O3 — CID 143773053
(3Z,7Z,11E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-[(Z)-prop-1-enoxy]-15-(1-propoxyethoxy)pentadeca-1,3,7,11-tetraene (PubChem CID 143773053) has the molecular formula C29H37F3O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is (3Z,7Z,11E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-[(Z)-prop-1-enoxy]-15-(1-propoxyethoxy)pentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-[(Z)-prop-1-enoxy]-15-(1-propoxyethoxy)pentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143773053 |
| Molecular Formula | C29H37F3O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | (3Z,7Z,11E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-[(Z)-prop-1-enoxy]-15-(1-propoxyethoxy)pentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)O/C=C\C)C(=C)/C(F)=C/C(=C)C(C)COC(C)OCCC |
| InChI | InChI=1S/C29H37F3O3/c1-11-15-33-25(9)29(32)28(31)24(8)20(4)14-13-19(3)23(7)27(30)17-21(5)22(6)18-35-26(10)34-16-12-2/h11,13-15,17,22,26H,3-5,7-9,12,16,18H2,1-2,6,10H3/b14-13-,15-11-,27-17+,29-28- |
| InChIKey | STSKYUJJSDTDOB-HAGKHAMWSA-N |
| XLogP | 8.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|