C30H41F3O4 — CID 143773161
(3Z,7Z,11E)-15-(1-butoxyethoxy)-2-(ethoxymethoxy)-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene (PubChem CID 143773161) has the molecular formula C30H41F3O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is (3Z,7Z,11E)-15-(1-butoxyethoxy)-2-(ethoxymethoxy)-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-15-(1-butoxyethoxy)-2-(ethoxymethoxy)-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143773161 |
| Molecular Formula | C30H41F3O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (3Z,7Z,11E)-15-(1-butoxyethoxy)-2-(ethoxymethoxy)-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)OCOCC)C(=C)/C=C(\F)C(=C)C(C)COC(C)OCCCC |
| InChI | InChI=1S/C30H41F3O4/c1-11-13-16-35-27(10)36-18-23(6)24(7)28(31)17-22(5)20(3)14-15-21(4)25(8)29(32)30(33)26(9)37-19-34-12-2/h14-15,17,23,27H,3-5,7-9,11-13,16,18-19H2,1-2,6,10H3/b15-14-,28-17+,30-29- |
| InChIKey | OKZVJDCWFDRYEH-ITUHDHQNSA-N |
| XLogP | 8.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|