C27H33F3O2 — CID 143773183
(3Z,7Z,11E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-15-propan-2-yloxy-2-prop-2-enoxypentadeca-1,3,7,11-tetraene (PubChem CID 143773183) has the molecular formula C27H33F3O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is (3Z,7Z,11E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-15-propan-2-yloxy-2-prop-2-enoxypentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-15-propan-2-yloxy-2-prop-2-enoxypentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143773183 |
| Molecular Formula | C27H33F3O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (3Z,7Z,11E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-15-propan-2-yloxy-2-prop-2-enoxypentadeca-1,3,7,11-tetraene |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C/C(=C)C(C)COC(C)C |
| InChI | InChI=1S/C27H33F3O2/c1-11-14-31-24(10)27(30)26(29)23(9)19(5)13-12-18(4)22(8)25(28)15-20(6)21(7)16-32-17(2)3/h11-13,15,17,21H,1,4-6,8-10,14,16H2,2-3,7H3/b13-12-,25-15+,27-26- |
| InChIKey | IYTOTLIHHDDMAO-HSQZYXTNSA-N |
| XLogP | 8.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|