C28H35F3O2 — CID 143773220
(3Z,7Z,11E)-15-but-3-en-2-yloxy-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-propoxypentadeca-1,3,7,11-tetraene (PubChem CID 143773220) has the molecular formula C28H35F3O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (3Z,7Z,11E)-15-but-3-en-2-yloxy-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-propoxypentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-15-but-3-en-2-yloxy-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-propoxypentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143773220 |
| Molecular Formula | C28H35F3O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | (3Z,7Z,11E)-15-but-3-en-2-yloxy-3,4,12-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-propoxypentadeca-1,3,7,11-tetraene |
| SMILES | C=CC(C)OCC(C)C(=C)/C(F)=C\C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)OCCC |
| InChI | InChI=1S/C28H35F3O2/c1-11-15-32-25(10)28(31)27(30)24(9)19(4)14-13-18(3)20(5)16-26(29)23(8)21(6)17-33-22(7)12-2/h12-14,16,21-22H,2-5,8-11,15,17H2,1,6-7H3/b14-13-,26-16+,28-27- |
| InChIKey | CWPUXPAMNKOVQO-LOPIBGSJSA-N |
| XLogP | 8.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|