C31H41F3O3 — CID 143773286
(3Z,7Z,11E)-2-but-3-enoxy-15-(1-butoxyethoxy)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene (PubChem CID 143773286) has the molecular formula C31H41F3O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is (3Z,7Z,11E)-2-but-3-enoxy-15-(1-butoxyethoxy)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-2-but-3-enoxy-15-(1-butoxyethoxy)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143773286 |
| Molecular Formula | C31H41F3O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | (3Z,7Z,11E)-2-but-3-enoxy-15-(1-butoxyethoxy)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene |
| SMILES | C=CCCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C\C(=C)C(=C)/C(F)=C/C(=C)C(C)COC(C)OCCCC |
| InChI | InChI=1S/C31H41F3O3/c1-11-13-17-35-27(9)31(34)30(33)26(8)22(4)16-15-21(3)25(7)29(32)19-23(5)24(6)20-37-28(10)36-18-14-12-2/h11,15-16,19,24,28H,1,3-5,7-9,12-14,17-18,20H2,2,6,10H3/b16-15-,29-19+,31-30- |
| InChIKey | XPEYOCIYNTZISG-DCKDLTRQSA-N |
| XLogP | 9.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|