C25H22FN3O2S — CID 143773362
N-cyclopropylsulfanyl-1-[(2-fluorophenyl)methyl]-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxamide (PubChem CID 143773362) has the molecular formula C25H22FN3O2S and a molecular weight of 447.54 g/mol. Its IUPAC name is N-cyclopropylsulfanyl-1-[(2-fluorophenyl)methyl]-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxamide.
| Compound Name | N-cyclopropylsulfanyl-1-[(2-fluorophenyl)methyl]-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 143773362 |
| Molecular Formula | C25H22FN3O2S |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-cyclopropylsulfanyl-1-[(2-fluorophenyl)methyl]-5-methyl-3-(2-oxo-1H-pyridin-3-yl)indole-2-carboxamide |
| SMILES | Cc1ccc2c(c1)c(-c1ccc[nH]c1=O)c(C(=O)NSC1CC1)n2Cc1ccccc1F |
| InChI | InChI=1S/C25H22FN3O2S/c1-15-8-11-21-19(13-15)22(18-6-4-12-27-24(18)30)23(25(31)28-32-17-9-10-17)29(21)14-16-5-2-3-7-20(16)26/h2-8,11-13,17H,9-10,14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | WWDZCFCAXFMSJI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|