C22H16F2N2O2 — CID 143773929
3-[2-acetyl-1-[(2,5-difluorophenyl)methyl]indol-3-yl]-1H-pyridin-2-one (PubChem CID 143773929) has the molecular formula C22H16F2N2O2 and a molecular weight of 378.38 g/mol. Its IUPAC name is 3-[2-acetyl-1-[(2,5-difluorophenyl)methyl]indol-3-yl]-1H-pyridin-2-one.
| Compound Name | 3-[2-acetyl-1-[(2,5-difluorophenyl)methyl]indol-3-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 143773929 |
| Molecular Formula | C22H16F2N2O2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-[2-acetyl-1-[(2,5-difluorophenyl)methyl]indol-3-yl]-1H-pyridin-2-one |
| SMILES | CC(=O)c1c(-c2ccc[nH]c2=O)c2ccccc2n1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C22H16F2N2O2/c1-13(27)21-20(17-6-4-10-25-22(17)28)16-5-2-3-7-19(16)26(21)12-14-11-15(23)8-9-18(14)24/h2-11H,12H2,1H3,(H,25,28) |
| InChIKey | XSCSZHNTIGPIPQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |