C30H36O4Si — CID 14377455
[(3aS,4S,6R,6aR)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 14377455) has the molecular formula C30H36O4Si and a molecular weight of 488.70 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,4S,6R,6aR)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 14377455 |
| Molecular Formula | C30H36O4Si |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [(3aS,4S,6R,6aR)-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[C@H]2c1ccccc1 |
| InChI | InChI=1S/C30H36O4Si/c1-29(2,3)35(23-17-11-7-12-18-23,24-19-13-8-14-20-24)31-21-25-27-28(34-30(4,5)33-27)26(32-25)22-15-9-6-10-16-22/h6-20,25-28H,21H2,1-5H3/t25-,26+,27-,28+/m1/s1 |
| InChIKey | OWIFOEVRMDQTLV-GCFVYEKYSA-N |
| XLogP | 5.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|