About 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane
6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane (PubChem CID 143775051) has the molecular formula C16H18ClN3O2S
and a molecular weight of 351.86 g/mol. Its IUPAC name is 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane.
Molecular Properties
| Compound Name | 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane |
| PubChem CID | 143775051 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane |
| SMILES | CC.CS(=O)(=O)c1ccccc1Nc1cc(Cl)nc2[nH]ccc12 |
| InChI | InChI=1S/C14H12ClN3O2S.C2H6/c1-21(19,20)12-5-3-2-4-10(12)17-11-8-13(15)18-14-9(11)6-7-16-14;1-2/h2-8H,1H3,(H2,16,17,18);1-2H3 |
| InChIKey | IJGGUDFARNQJOL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane?
The IUPAC name of 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane (CID 143775051) is 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane.
What is the SMILES notation for 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane?
The canonical SMILES for 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane is CC.CS(=O)(=O)c1ccccc1Nc1cc(Cl)nc2[nH]ccc12.
What is the InChIKey of 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane?
The InChIKey is IJGGUDFARNQJOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN3O2S.C2H6/c1-21(19,20)12-5-3-2-4-10(12)17-11-8-13(15)18-14-9(11)6-7-16-14;1-2/h2-8H,1H3,(H2,16,17,18);1-2H3.
What are the key properties of 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane?
6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane has a molecular weight of 351.86 g/mol, XLogP of 4.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2-methylsulfonylphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine;ethane is sourced from PubChem (CID 143775051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).