C11H10Cl2N2O — CID 143775570
3,5-dichloro-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazin-2-one (PubChem CID 143775570) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is 3,5-dichloro-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazin-2-one.
| Compound Name | 3,5-dichloro-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazin-2-one |
|---|---|
| PubChem CID | 143775570 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 3,5-dichloro-1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazin-2-one |
| SMILES | C=C/C=C(\C=C/C)n1cc(Cl)nc(Cl)c1=O |
| InChI | InChI=1S/C11H10Cl2N2O/c1-3-5-8(6-4-2)15-7-9(12)14-10(13)11(15)16/h3-7H,1H2,2H3/b6-4-,8-5+ |
| InChIKey | WYQSCVGZIAYKTM-QXMOYCCXSA-N |
| XLogP | 3.15 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|