C7H11NO3 — CID 143776070
6,6-dimethyl-1,4-oxazepane-2,3-dione (PubChem CID 143776070) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 6,6-dimethyl-1,4-oxazepane-2,3-dione.
| Compound Name | 6,6-dimethyl-1,4-oxazepane-2,3-dione |
|---|---|
| PubChem CID | 143776070 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 6,6-dimethyl-1,4-oxazepane-2,3-dione |
| SMILES | CC1(C)CNC(=O)C(=O)OC1 |
| InChI | InChI=1S/C7H11NO3/c1-7(2)3-8-5(9)6(10)11-4-7/h3-4H2,1-2H3,(H,8,9) |
| InChIKey | RYFNWPYRRJWYOJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|