About ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one
ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one (PubChem CID 143776228) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one |
| PubChem CID | 143776228 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one |
| SMILES | CC.CN1Cc2ccncc2NC1=O |
| InChI | InChI=1S/C8H9N3O.C2H6/c1-11-5-6-2-3-9-4-7(6)10-8(11)12;1-2/h2-4H,5H2,1H3,(H,10,12);1-2H3 |
| InChIKey | NMOMKSQIKFZKLZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one?
The IUPAC name of ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one (CID 143776228) is ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one.
What is the SMILES notation for ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one?
The canonical SMILES for ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one is CC.CN1Cc2ccncc2NC1=O.
What is the InChIKey of ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one?
The InChIKey is NMOMKSQIKFZKLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O.C2H6/c1-11-5-6-2-3-9-4-7(6)10-8(11)12;1-2/h2-4H,5H2,1H3,(H,10,12);1-2H3.
What are the key properties of ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one?
ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one has a molecular weight of 193.25 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1,4-dihydropyrido[3,4-d]pyrimidin-2-one is sourced from PubChem (CID 143776228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).