C27H39FN6O3 — CID 143776686
4-[3-[4-[(2S)-2-amino-3-[(2S)-2-cyanopyrrolidin-1-yl]-3-oxopropyl]-3-fluorophenoxy]propyl]-N-(1-amino-2-methylpropylidene)piperidine-1-carboxamide (PubChem CID 143776686) has the molecular formula C27H39FN6O3 and a molecular weight of 514.65 g/mol. Its IUPAC name is 4-[3-[4-[(2S)-2-amino-3-[(2S)-2-cyanopyrrolidin-1-yl]-3-oxopropyl]-3-fluorophenoxy]propyl]-N-(1-amino-2-methylpropylidene)piperidine-1-carboxamide.
| Compound Name | 4-[3-[4-[(2S)-2-amino-3-[(2S)-2-cyanopyrrolidin-1-yl]-3-oxopropyl]-3-fluorophenoxy]propyl]-N-(1-amino-2-methylpropylidene)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143776686 |
| Molecular Formula | C27H39FN6O3 |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 4-[3-[4-[(2S)-2-amino-3-[(2S)-2-cyanopyrrolidin-1-yl]-3-oxopropyl]-3-fluorophenoxy]propyl]-N-(1-amino-2-methylpropylidene)piperidine-1-carboxamide |
| SMILES | CC(C)C(N)=NC(=O)N1CCC(CCCOc2ccc(C[C@H](N)C(=O)N3CCC[C@H]3C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C27H39FN6O3/c1-18(2)25(31)32-27(36)33-12-9-19(10-13-33)5-4-14-37-22-8-7-20(23(28)16-22)15-24(30)26(35)34-11-3-6-21(34)17-29/h7-8,16,18-19,21,24H,3-6,9-15,30H2,1-2H3,(H2,31,32,36)/t21-,24-/m0/s1 |
| InChIKey | HYHACNDLVNISTQ-URXFXBBRSA-N |
| XLogP | 3.21 |
| TPSA | 138.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|