C23H32N2O4 — CID 143776857
methyl (4aS,8aR)-6-(benzylamino)-2-[(2-methylpropan-2-yl)oxy]-1-(oxomethylidene)-4,4a,5,6,7,8-hexahydro-3H-isoquinoline-8a-carboxylate (PubChem CID 143776857) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is methyl (4aS,8aR)-6-(benzylamino)-2-[(2-methylpropan-2-yl)oxy]-1-(oxomethylidene)-4,4a,5,6,7,8-hexahydro-3H-isoquinoline-8a-carboxylate.
| Compound Name | methyl (4aS,8aR)-6-(benzylamino)-2-[(2-methylpropan-2-yl)oxy]-1-(oxomethylidene)-4,4a,5,6,7,8-hexahydro-3H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 143776857 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | methyl (4aS,8aR)-6-(benzylamino)-2-[(2-methylpropan-2-yl)oxy]-1-(oxomethylidene)-4,4a,5,6,7,8-hexahydro-3H-isoquinoline-8a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(NCc3ccccc3)C[C@@H]1CCN(OC(C)(C)C)C2=C=O |
| InChI | InChI=1S/C23H32N2O4/c1-22(2,3)29-25-13-11-18-14-19(24-15-17-8-6-5-7-9-17)10-12-23(18,20(25)16-26)21(27)28-4/h5-9,18-19,24H,10-15H2,1-4H3/t18-,19?,23+/m0/s1 |
| InChIKey | BQEMWTYGXWXLRK-IZUFOGEXSA-N |
| XLogP | 3.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|