C18H24N2O2S — CID 143776877
ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonyl-5-methylindol-4-amine (PubChem CID 143776877) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonyl-5-methylindol-4-amine.
| Compound Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonyl-5-methylindol-4-amine |
|---|---|
| PubChem CID | 143776877 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | ethane;1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonyl-5-methylindol-4-amine |
| SMILES | C=C/C(=C\C=C/C)S(=O)(=O)n1ccc2c(N)c(C)ccc21.CC |
| InChI | InChI=1S/C16H18N2O2S.C2H6/c1-4-6-7-13(5-2)21(19,20)18-11-10-14-15(18)9-8-12(3)16(14)17;1-2/h4-11H,2,17H2,1,3H3;1-2H3/b6-4-,13-7+; |
| InChIKey | KLTWNHAZHVKDAZ-ZJPWNLOHSA-N |
| XLogP | 4.38 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|