C27H44F2O — CID 143776904
1-[[(3Z)-3,4-difluoro-6,9,10-trimethyl-5-methylidenetetradeca-1,3-dien-2-yl]oxymethyl]-4-ethenylcyclohexane (PubChem CID 143776904) has the molecular formula C27H44F2O and a molecular weight of 422.64 g/mol. Its IUPAC name is 1-[[(3Z)-3,4-difluoro-6,9,10-trimethyl-5-methylidenetetradeca-1,3-dien-2-yl]oxymethyl]-4-ethenylcyclohexane.
| Compound Name | 1-[[(3Z)-3,4-difluoro-6,9,10-trimethyl-5-methylidenetetradeca-1,3-dien-2-yl]oxymethyl]-4-ethenylcyclohexane |
|---|---|
| PubChem CID | 143776904 |
| Molecular Formula | C27H44F2O |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | 1-[[(3Z)-3,4-difluoro-6,9,10-trimethyl-5-methylidenetetradeca-1,3-dien-2-yl]oxymethyl]-4-ethenylcyclohexane |
| SMILES | C=CC1CCC(COC(=C)/C(F)=C(/F)C(=C)C(C)CCC(C)C(C)CCCC)CC1 |
| InChI | InChI=1S/C27H44F2O/c1-8-10-11-19(3)20(4)12-13-21(5)22(6)26(28)27(29)23(7)30-18-25-16-14-24(9-2)15-17-25/h9,19-21,24-25H,2,6-8,10-18H2,1,3-5H3/b27-26- |
| InChIKey | VRLLJGDCPPJZQU-RQZHXJHFSA-N |
| XLogP | 9.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|