C17H28O2 — CID 143777164
(E,3Z)-6-tert-butyl-3-(1-hydroxyprop-2-enylidene)-8-methylnon-4-en-2-one (PubChem CID 143777164) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (E,3Z)-6-tert-butyl-3-(1-hydroxyprop-2-enylidene)-8-methylnon-4-en-2-one.
| Compound Name | (E,3Z)-6-tert-butyl-3-(1-hydroxyprop-2-enylidene)-8-methylnon-4-en-2-one |
|---|---|
| PubChem CID | 143777164 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (E,3Z)-6-tert-butyl-3-(1-hydroxyprop-2-enylidene)-8-methylnon-4-en-2-one |
| SMILES | C=C/C(O)=C(\C=C\C(CC(C)C)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C17H28O2/c1-8-16(19)15(13(4)18)10-9-14(11-12(2)3)17(5,6)7/h8-10,12,14,19H,1,11H2,2-7H3/b10-9+,16-15- |
| InChIKey | DTFSBRDRWCSNKC-WXJFLGMWSA-N |
| XLogP | 4.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|