C13H26B2O4 — CID 143777204
5,5-dimethyl-2-[2-(2,4,5,5-tetramethyl-1,3,2-dioxaborolan-4-yl)ethyl]-1,3,2-dioxaborinane (PubChem CID 143777204) has the molecular formula C13H26B2O4 and a molecular weight of 267.97 g/mol. Its IUPAC name is 5,5-dimethyl-2-[2-(2,4,5,5-tetramethyl-1,3,2-dioxaborolan-4-yl)ethyl]-1,3,2-dioxaborinane.
| Compound Name | 5,5-dimethyl-2-[2-(2,4,5,5-tetramethyl-1,3,2-dioxaborolan-4-yl)ethyl]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 143777204 |
| Molecular Formula | C13H26B2O4 |
| Molecular Weight | 267.97 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 5,5-dimethyl-2-[2-(2,4,5,5-tetramethyl-1,3,2-dioxaborolan-4-yl)ethyl]-1,3,2-dioxaborinane |
| SMILES | CB1OC(C)(C)C(C)(CCB2OCC(C)(C)CO2)O1 |
| InChI | InChI=1S/C13H26B2O4/c1-11(2)9-16-15(17-10-11)8-7-13(5)12(3,4)18-14(6)19-13/h7-10H2,1-6H3 |
| InChIKey | CMJDSKZKZVRCGP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.97 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|