About 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine
1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine (PubChem CID 143777487) has the molecular formula C13H16ClN5
and a molecular weight of 277.76 g/mol. Its IUPAC name is 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine |
| PubChem CID | 143777487 |
| Molecular Formula | C13H16ClN5 |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine |
| SMILES | CC1CN(c2nnc(Cl)c3ccncc23)CCN1C |
| InChI | InChI=1S/C13H16ClN5/c1-9-8-19(6-5-18(9)2)13-11-7-15-4-3-10(11)12(14)16-17-13/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | LOKPYDJUERULDX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine?
The IUPAC name of 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine (CID 143777487) is 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine.
What is the SMILES notation for 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine?
The canonical SMILES for 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine is CC1CN(c2nnc(Cl)c3ccncc23)CCN1C.
What is the InChIKey of 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine?
The InChIKey is LOKPYDJUERULDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN5/c1-9-8-19(6-5-18(9)2)13-11-7-15-4-3-10(11)12(14)16-17-13/h3-4,7,9H,5-6,8H2,1-2H3.
What are the key properties of 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine?
1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine has a molecular weight of 277.76 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(3,4-dimethylpiperazin-1-yl)pyrido[3,4-d]pyridazine is sourced from PubChem (CID 143777487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).