C24H27FN4O4 — CID 143777687
8-amino-7-fluoro-6-[2-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]amino]ethylamino]-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-3,1'-cyclobutane]-11-carboxylic acid (PubChem CID 143777687) has the molecular formula C24H27FN4O4 and a molecular weight of 454.50 g/mol. Its IUPAC name is 8-amino-7-fluoro-6-[2-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]amino]ethylamino]-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-3,1'-cyclobutane]-11-carboxylic acid.
| Compound Name | 8-amino-7-fluoro-6-[2-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]amino]ethylamino]-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-3,1'-cyclobutane]-11-carboxylic acid |
|---|---|
| PubChem CID | 143777687 |
| Molecular Formula | C24H27FN4O4 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 8-amino-7-fluoro-6-[2-[[(3Z,5Z)-hepta-1,3,5-trien-2-yl]amino]ethylamino]-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-3,1'-cyclobutane]-11-carboxylic acid |
| SMILES | C=C(/C=C\C=C/C)NCCNc1c(F)c(N)c2c(=O)c(C(=O)O)cn3c2c1OC1(CCC1)C3 |
| InChI | InChI=1S/C24H27FN4O4/c1-3-4-5-7-14(2)27-10-11-28-19-17(25)18(26)16-20-22(19)33-24(8-6-9-24)13-29(20)12-15(21(16)30)23(31)32/h3-5,7,12,27-28H,2,6,8-11,13,26H2,1H3,(H,31,32)/b4-3-,7-5- |
| InChIKey | QYUMEGLMVNUEAZ-MRWCJKGFSA-N |
| XLogP | 3.38 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|