About ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide
ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide (PubChem CID 143777845) has the molecular formula C19H39NOS
and a molecular weight of 329.59 g/mol. Its IUPAC name is ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide.
Molecular Properties
| Compound Name | ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide |
| PubChem CID | 143777845 |
| Molecular Formula | C19H39NOS |
| Molecular Weight | 329.59 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide |
| SMILES | CC.CC.CC.CC1CCCC(NS(=O)C2=CCCC=C2)C1 |
| InChI | InChI=1S/C13H21NOS.3C2H6/c1-11-6-5-7-12(10-11)14-16(15)13-8-3-2-4-9-13;3*1-2/h3,8-9,11-12,14H,2,4-7,10H2,1H3;3*1-2H3 |
| InChIKey | DEOCIHDNWXVTSQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide?
The IUPAC name of ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide (CID 143777845) is ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide.
What is the SMILES notation for ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide?
The canonical SMILES for ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide is CC.CC.CC.CC1CCCC(NS(=O)C2=CCCC=C2)C1.
What is the InChIKey of ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide?
The InChIKey is DEOCIHDNWXVTSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NOS.3C2H6/c1-11-6-5-7-12(10-11)14-16(15)13-8-3-2-4-9-13;3*1-2/h3,8-9,11-12,14H,2,4-7,10H2,1H3;3*1-2H3.
What are the key properties of ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide?
ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide has a molecular weight of 329.59 g/mol, XLogP of 6.13, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide is sourced from PubChem (CID 143777845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).