C27H36ClN3O6 — CID 143777990
4-chloro-2-[4-(4-methoxyphenyl)-3-methyl-1,2-oxazol-5-yl]phenol;N-methylhydroxylamine;N-(8-oxooctyl)formamide (PubChem CID 143777990) has the molecular formula C27H36ClN3O6 and a molecular weight of 534.05 g/mol. Its IUPAC name is 4-chloro-2-[4-(4-methoxyphenyl)-3-methyl-1,2-oxazol-5-yl]phenol;N-methylhydroxylamine;N-(8-oxooctyl)formamide.
| Compound Name | 4-chloro-2-[4-(4-methoxyphenyl)-3-methyl-1,2-oxazol-5-yl]phenol;N-methylhydroxylamine;N-(8-oxooctyl)formamide |
|---|---|
| PubChem CID | 143777990 |
| Molecular Formula | C27H36ClN3O6 |
| Molecular Weight | 534.05 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 4-chloro-2-[4-(4-methoxyphenyl)-3-methyl-1,2-oxazol-5-yl]phenol;N-methylhydroxylamine;N-(8-oxooctyl)formamide |
| SMILES | CNO.COc1ccc(-c2c(C)noc2-c2cc(Cl)ccc2O)cc1.O=CCCCCCCCNC=O |
| InChI | InChI=1S/C17H14ClNO3.C9H17NO2.CH5NO/c1-10-16(11-3-6-13(21-2)7-4-11)17(22-19-10)14-9-12(18)5-8-15(14)20;11-8-6-4-2-1-3-5-7-10-9-12;1-2-3/h3-9,20H,1-2H3;8-9H,1-7H2,(H,10,12);2-3H,1H3 |
| InChIKey | FVIPAZMAARASAH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 133.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.05 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|