C15H29BO2 — CID 143778501
(3aS,7aR)-3a-methyl-2-(3-methylbutyl)-4-propan-2-yl-5,6,7,7a-tetrahydro-4H-benzo[d][1,3,2]dioxaborole (PubChem CID 143778501) has the molecular formula C15H29BO2 and a molecular weight of 252.21 g/mol. Its IUPAC name is (3aS,7aR)-3a-methyl-2-(3-methylbutyl)-4-propan-2-yl-5,6,7,7a-tetrahydro-4H-benzo[d][1,3,2]dioxaborole.
| Compound Name | (3aS,7aR)-3a-methyl-2-(3-methylbutyl)-4-propan-2-yl-5,6,7,7a-tetrahydro-4H-benzo[d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 143778501 |
| Molecular Formula | C15H29BO2 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | (3aS,7aR)-3a-methyl-2-(3-methylbutyl)-4-propan-2-yl-5,6,7,7a-tetrahydro-4H-benzo[d][1,3,2]dioxaborole |
| SMILES | CC(C)CCB1O[C@@H]2CCCC(C(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C15H29BO2/c1-11(2)9-10-16-17-14-8-6-7-13(12(3)4)15(14,5)18-16/h11-14H,6-10H2,1-5H3/t13?,14-,15+/m1/s1 |
| InChIKey | HKPBMMCSYPLRFL-DMJDIKPUSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|