C28H33ClF3N3O2 — CID 143778735
1-[1-(3-chloro-4,5-difluorophenyl)ethenylamino]-N-[(1R)-1-[4-[(2S,5R)-2,5-dimethylpyrrolidine-1-carbonyl]-6-fluoro-3-methylcyclohexa-1,5-dien-1-yl]ethyl]cyclopropane-1-carboxamide (PubChem CID 143778735) has the molecular formula C28H33ClF3N3O2 and a molecular weight of 536.04 g/mol. Its IUPAC name is 1-[1-(3-chloro-4,5-difluorophenyl)ethenylamino]-N-[(1R)-1-[4-[(2S,5R)-2,5-dimethylpyrrolidine-1-carbonyl]-6-fluoro-3-methylcyclohexa-1,5-dien-1-yl]ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[1-(3-chloro-4,5-difluorophenyl)ethenylamino]-N-[(1R)-1-[4-[(2S,5R)-2,5-dimethylpyrrolidine-1-carbonyl]-6-fluoro-3-methylcyclohexa-1,5-dien-1-yl]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143778735 |
| Molecular Formula | C28H33ClF3N3O2 |
| Molecular Weight | 536.04 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 1-[1-(3-chloro-4,5-difluorophenyl)ethenylamino]-N-[(1R)-1-[4-[(2S,5R)-2,5-dimethylpyrrolidine-1-carbonyl]-6-fluoro-3-methylcyclohexa-1,5-dien-1-yl]ethyl]cyclopropane-1-carboxamide |
| SMILES | C=C(NC1(C(=O)N[C@H](C)C2=CC(C)C(C(=O)N3[C@H](C)CC[C@@H]3C)C=C2F)CC1)c1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C28H33ClF3N3O2/c1-14-10-21(23(30)13-20(14)26(36)35-15(2)6-7-16(35)3)18(5)33-27(37)28(8-9-28)34-17(4)19-11-22(29)25(32)24(31)12-19/h10-16,18,20,34H,4,6-9H2,1-3,5H3,(H,33,37)/t14?,15-,16+,18-,20?/m1/s1 |
| InChIKey | MGUMZTLAWSWLQJ-RBOZJLENSA-N |
| XLogP | 5.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.04 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|