C14H22N2 — CID 143778931
2-butyl-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,4-dihydropyrazole (PubChem CID 143778931) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-butyl-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,4-dihydropyrazole.
| Compound Name | 2-butyl-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 143778931 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-butyl-3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,4-dihydropyrazole |
| SMILES | C=C/C=C(\C=C/C)C1CC=NN1CCCC |
| InChI | InChI=1S/C14H22N2/c1-4-7-12-16-14(10-11-15-16)13(8-5-2)9-6-3/h5-6,8-9,11,14H,2,4,7,10,12H2,1,3H3/b9-6-,13-8+ |
| InChIKey | GWNHRTZHHSJKJG-CMLKFSTMSA-N |
| XLogP | 3.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|