C15H22N2O — CID 14377898
11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridec-5-en-4-one (PubChem CID 14377898) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridec-5-en-4-one.
| Compound Name | 11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridec-5-en-4-one |
|---|---|
| PubChem CID | 14377898 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 11-but-3-enyl-7,11-diazatricyclo[7.3.1.02,7]tridec-5-en-4-one |
| SMILES | C=CCCN1CC2CC(C1)C1CC(=O)C=CN1C2 |
| InChI | InChI=1S/C15H22N2O/c1-2-3-5-16-9-12-7-13(11-16)15-8-14(18)4-6-17(15)10-12/h2,4,6,12-13,15H,1,3,5,7-11H2 |
| InChIKey | QEFLZWOIQICVRH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|