About 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane
2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane (PubChem CID 143779381) has the molecular formula C18H32N2OS
and a molecular weight of 324.53 g/mol. Its IUPAC name is 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane.
Molecular Properties
| Compound Name | 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane |
| PubChem CID | 143779381 |
| Molecular Formula | C18H32N2OS |
| Molecular Weight | 324.53 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane |
| SMILES | C.CCOCc1csc(C2CCN(C3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C17H28N2OS.CH4/c1-2-20-12-15-13-21-17(18-15)14-8-10-19(11-9-14)16-6-4-3-5-7-16;/h13-14,16H,2-12H2,1H3;1H4 |
| InChIKey | FSSKMDGMCUXDEB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane?
The IUPAC name of 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane (CID 143779381) is 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane.
What is the SMILES notation for 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane?
The canonical SMILES for 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane is C.CCOCc1csc(C2CCN(C3CCCCC3)CC2)n1.
What is the InChIKey of 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane?
The InChIKey is FSSKMDGMCUXDEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2OS.CH4/c1-2-20-12-15-13-21-17(18-15)14-8-10-19(11-9-14)16-6-4-3-5-7-16;/h13-14,16H,2-12H2,1H3;1H4.
What are the key properties of 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane?
2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane has a molecular weight of 324.53 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclohexylpiperidin-4-yl)-4-(ethoxymethyl)-1,3-thiazole;methane is sourced from PubChem (CID 143779381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).