About 7-methyl-1,4-dihydrocyclohepta[b]phosphole
7-methyl-1,4-dihydrocyclohepta[b]phosphole (PubChem CID 143779610) has the molecular formula C10H11P
and a molecular weight of 162.17 g/mol. Its IUPAC name is 7-methyl-1,4-dihydrocyclohepta[b]phosphole.
Molecular Properties
| Compound Name | 7-methyl-1,4-dihydrocyclohepta[b]phosphole |
| PubChem CID | 143779610 |
| Molecular Formula | C10H11P |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 7-methyl-1,4-dihydrocyclohepta[b]phosphole |
| SMILES | CC1=Cc2[pH]ccc2CC=C1 |
| InChI | InChI=1S/C10H11P/c1-8-3-2-4-9-5-6-11-10(9)7-8/h2-3,5-7,11H,4H2,1H3 |
| InChIKey | YDAFPYLHGRXMFN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-methyl-1,4-dihydrocyclohepta[b]phosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,4-dihydrocyclohepta[b]phosphole?
The IUPAC name of 7-methyl-1,4-dihydrocyclohepta[b]phosphole (CID 143779610) is 7-methyl-1,4-dihydrocyclohepta[b]phosphole.
What is the SMILES notation for 7-methyl-1,4-dihydrocyclohepta[b]phosphole?
The canonical SMILES for 7-methyl-1,4-dihydrocyclohepta[b]phosphole is CC1=Cc2[pH]ccc2CC=C1.
What is the InChIKey of 7-methyl-1,4-dihydrocyclohepta[b]phosphole?
The InChIKey is YDAFPYLHGRXMFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11P/c1-8-3-2-4-9-5-6-11-10(9)7-8/h2-3,5-7,11H,4H2,1H3.
What are the key properties of 7-methyl-1,4-dihydrocyclohepta[b]phosphole?
7-methyl-1,4-dihydrocyclohepta[b]phosphole has a molecular weight of 162.17 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,4-dihydrocyclohepta[b]phosphole is sourced from PubChem (CID 143779610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).