About (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol
(3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol (PubChem CID 143780082) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol.
Molecular Properties
| Compound Name | (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol |
| PubChem CID | 143780082 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=C)C(O)CNC |
| InChI | InChI=1S/C9H15NO/c1-4-6-8(5-2)9(11)7-10-3/h4-6,9-11H,1-2,7H2,3H3/b8-6+ |
| InChIKey | DMUASIWIXOULOH-SOFGYWHQSA-N |
| XLogP | 0.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol?
The IUPAC name of (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol (CID 143780082) is (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol.
What is the SMILES notation for (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol?
The canonical SMILES for (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol is C=C/C=C(\C=C)C(O)CNC.
What is the InChIKey of (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol?
The InChIKey is DMUASIWIXOULOH-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-6-8(5-2)9(11)7-10-3/h4-6,9-11H,1-2,7H2,3H3/b8-6+.
What are the key properties of (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol?
(3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol has a molecular weight of 153.22 g/mol, XLogP of 0.87, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-ethenyl-1-(methylamino)hexa-3,5-dien-2-ol is sourced from PubChem (CID 143780082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).